720-44-5 4-Methoxybenzhydrol
| Nome del prodotto |
4-Methoxybenzhydrol |
| Nome inglese |
4-Methoxybenzhydrol; 4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol; (4-methoxyphenyl)(phenyl)methanol |
| Formula molecolare |
C14H14O2 |
| Peso Molecolare |
214.2598 |
| InChI |
InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
| Numero CAS |
720-44-5 |
| EINECS |
211-953-9 |
| Struttura molecolare |
|
| Densità |
1.121g/cm3 |
| Punto di ebollizione |
363.2°C at 760 mmHg |
| Indice di rifrazione |
1.582 |
| Punto d'infiammabilità |
164.5°C |
| Pressione di vapore |
6.55E-06mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|