ChemNet > CAS > 7144-65-2 2-Biphenylyl glycidyl ether
7144-65-2 2-Biphenylyl glycidyl ether
| Nome del prodotto |
2-Biphenylyl glycidyl ether |
| Nome inglese |
2-Biphenylyl glycidyl ether; 3-(2-Biphenylyloxy)-1,2-epoxypropane; biphenyl-2-yl 2,3-epoxypropyl ether; ortho-phenylphenolglycidylether; 2-((1,1'-biphenyl-2-yloxy)methyl)-oxiran ; 3-(2-biphenyloxy)propylene oxide; 3-(2-xenyloxy)propylene oxide; 1-(2-biphenylyloxy)-2,3-epoxy-propan; 1-(Biphenyloxy)-2,3-epoxypropane; 2-[(biphenyl-2-yloxy)methyl]oxirane; (2S)-2-[(biphenyl-2-yloxy)methyl]oxirane; (2R)-2-[(biphenyl-2-yloxy)methyl]oxirane |
| Formula molecolare |
C15H14O2 |
| Peso Molecolare |
226.2705 |
| InChI |
InChI=1/C15H14O2/c1-2-6-12(7-3-1)14-8-4-5-9-15(14)17-11-13-10-16-13/h1-9,13H,10-11H2/t13-/m1/s1 |
| Numero CAS |
7144-65-2 |
| EINECS |
230-451-0 |
| Struttura molecolare |
|
| Densità |
1.136g/cm3 |
| Punto di fusione |
30-32℃ |
| Punto di ebollizione |
371°C at 760 mmHg |
| Indice di rifrazione |
1.581 |
| Punto d'infiammabilità |
137.3°C |
| Pressione di vapore |
2.28E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|