70-57-5 5-Methylnicotinamide
| Nome del prodotto |
5-Methylnicotinamide |
| Nome inglese |
5-Methylnicotinamide; 5-Methylpyridine-3-carboxamide |
| Formula molecolare |
C7H8N2O |
| Peso Molecolare |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
| Numero CAS |
70-57-5 |
| Struttura molecolare |
|
| Densità |
1.157g/cm3 |
| Punto di ebollizione |
290°C at 760 mmHg |
| Indice di rifrazione |
1.561 |
| Punto d'infiammabilità |
129.2°C |
| Pressione di vapore |
0.00213mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|