ChemNet > CAS > 696-04-8 dihydrothymine crystalline
696-04-8 dihydrothymine crystalline
| Nome del prodotto |
dihydrothymine crystalline |
| Nome inglese |
dihydrothymine crystalline; 5,6-Dihydro-5-methyluracil; Dihydrothymine; 5-Methyl-5,6-dihydrouracil; 5-methyldihydropyrimidine-2,4(1H,3H)-dione; (5S)-5-methyldihydropyrimidine-2,4(1H,3H)-dione; (5R)-5-methyldihydropyrimidine-2,4(1H,3H)-dione |
| Formula molecolare |
C5H8N2O2 |
| Peso Molecolare |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c1-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9)/t3-/m1/s1 |
| Numero CAS |
696-04-8 |
| EINECS |
211-787-7 |
| Struttura molecolare |
|
| Densità |
1.149g/cm3 |
| Indice di rifrazione |
1.452 |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|