623-76-7 1,3-diethylurea
| Nome del prodotto |
1,3-diethylurea |
| Nome inglese |
1,3-diethylurea; N,N-Diethylurea; Diethylurea symmetrical; N,N'-Diethylurea |
| Formula molecolare |
C5H12N2O |
| Peso Molecolare |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
| Numero CAS |
623-76-7 |
| EINECS |
210-811-3 |
| Struttura molecolare |
|
| Densità |
0.923g/cm3 |
| Punto di fusione |
112-113℃ |
| Punto di ebollizione |
263°C at 760 mmHg |
| Indice di rifrazione |
1.428 |
| Punto d'infiammabilità |
121.1°C |
| Pressione di vapore |
0.0106mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|