ChemNet > CAS > 613-92-3 N'-hydroxybenzenecarboximidamide
613-92-3 N'-hydroxybenzenecarboximidamide
| Nome del prodotto |
N'-hydroxybenzenecarboximidamide |
| Nome inglese |
N'-hydroxybenzenecarboximidamide; Benzamidoxime; N-Hydroxy-Benzamidine |
| Formula molecolare |
C7H8N2O |
| Peso Molecolare |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
| Numero CAS |
613-92-3 |
| EINECS |
210-361-8 |
| Struttura molecolare |
|
| Densità |
1.18g/cm3 |
| Punto di fusione |
60℃ |
| Punto di ebollizione |
307.4°C at 760 mmHg |
| Indice di rifrazione |
1.574 |
| Punto d'infiammabilità |
139.7°C |
| Pressione di vapore |
0.000315mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|