537-47-3 4-Phenylsemicarbazide
| Nome del prodotto |
4-Phenylsemicarbazide |
| Nome inglese |
4-Phenylsemicarbazide; Phenylsemicarbazide |
| Formula molecolare |
C7H9N3O |
| Peso Molecolare |
151.16
|
| InChI |
InChI=1/C7H9N3O/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
| Numero CAS |
537-47-3 |
| EINECS |
208-669-2 |
| Struttura molecolare |
|
| Punto di fusione |
122-127℃ |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|