ChemNet > CAS > 5228-49-9 1-Methyl-5-nitroindazole
5228-49-9 1-Methyl-5-nitroindazole
| Nome del prodotto |
1-Methyl-5-nitroindazole |
| Nome inglese |
1-Methyl-5-nitroindazole; 1-methyl-5-nitro-1H-indazole |
| Formula molecolare |
C8H7N3O2 |
| Peso Molecolare |
177.1601 |
| InChI |
InChI=1/C8H7N3O2/c1-10-8-3-2-7(11(12)13)4-6(8)5-9-10/h2-5H,1H3 |
| Numero CAS |
5228-49-9 |
| Struttura molecolare |
|
| Densità |
1.425g/cm3 |
| Punto di ebollizione |
332.863°C at 760 mmHg |
| Indice di rifrazione |
1.677 |
| Punto d'infiammabilità |
155.11°C |
| Pressione di vapore |
0mmHg at 25°C |
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|