452-68-6 2-Fluoro-5-Iodotoluene
| Nome del prodotto |
2-Fluoro-5-Iodotoluene |
| Nome inglese |
2-Fluoro-5-Iodotoluene; |
| Formula molecolare |
C7H6FI |
| Peso Molecolare |
236.02 |
| InChI |
InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Numero CAS |
452-68-6 |
| EINECS |
207-206-1 |
| Struttura molecolare |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|