4358-86-5;4410-31-5 DL-Mandelamide
| Nome del prodotto |
DL-Mandelamide |
| Nome inglese |
DL-Mandelamide;Mandelamide; NSC 16603; Benzeneacetamide, alpha-hydroxy-; 2-hydroxy-2-phenylacetamide |
| Formula molecolare |
C8H9NO2 |
| Peso Molecolare |
151.1626 |
| InChI |
InChI=1/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11) |
| Numero CAS |
4358-86-5;4410-31-5 |
| Struttura molecolare |
|
| Densità |
1.246g/cm3 |
| Punto di ebollizione |
345.5°C at 760 mmHg |
| Indice di rifrazione |
1.589 |
| Punto d'infiammabilità |
162.7°C |
| Pressione di vapore |
2.33E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|