2396-84-1 ethyl sorbate
| Nome del prodotto |
ethyl sorbate |
| Nome inglese |
ethyl sorbate; Ethyl 2,4-hexadienoate~Sorbic acid ethyl ester; (E,E)-2,4-Hexadienoic acid ethylester; Ethyl trans,trans-2,4-hexadienoate; ethyl hexa-2,4-dienoate; ethyl (2E,4E)-hexa-2,4-dienoate; ethyl (2Z,4Z)-hexa-2,4-dienoate |
| Formula molecolare |
C8H12O2 |
| Peso Molecolare |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3-,7-6- |
| Numero CAS |
2396-84-1 |
| EINECS |
219-258-2 |
| Struttura molecolare |
|
| Densità |
0.926g/cm3 |
| Punto di ebollizione |
195.5°C at 760 mmHg |
| Indice di rifrazione |
1.454 |
| Punto d'infiammabilità |
69.4°C |
| Pressione di vapore |
0.418mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|