ChemNet > CAS > 2299-73-2 4-Methoxybenzaldehyde azine
2299-73-2 4-Methoxybenzaldehyde azine
| Nome del prodotto |
4-Methoxybenzaldehyde azine |
| Nome inglese |
4-Methoxybenzaldehyde azine; p-Anisaldehyde azine; 4-Methoxybenzalazine; bis(4-methoxybenzylidene)hydrazine; (1E,2E)-bis[(4-methoxyphenyl)methylidene]hydrazine |
| Formula molecolare |
C16H16N2O2 |
| Peso Molecolare |
268.31 |
| InChI |
InChI=1/C16H16N2O2/c1-19-15-7-3-13(4-8-15)11-17-18-12-14-5-9-16(20-2)10-6-14/h3-12H,1-2H3/b17-11+,18-12u |
| Numero CAS |
2299-73-2 |
| Struttura molecolare |
|
| Indice di rifrazione |
1.54 |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|