2051-31-2 4-Decanol
| Nome del prodotto |
4-Decanol |
| Nome inglese |
4-Decanol; n-Hexyl n-propyl carbinol; decan-4-ol; (4R)-decan-4-ol; (4S)-decan-4-ol |
| Formula molecolare |
C10H22O |
| Peso Molecolare |
158.2811 |
| InChI |
InChI=1/C10H22O/c1-3-5-6-7-9-10(11)8-4-2/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
| Numero CAS |
2051-31-2 |
| EINECS |
218-117-2 |
| Struttura molecolare |
|
| Densità |
0.826g/cm3 |
| Punto di ebollizione |
213.4°C at 760 mmHg |
| Indice di rifrazione |
1.434 |
| Punto d'infiammabilità |
82.2°C |
| Pressione di vapore |
0.0365mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|