1444-65-1 2-Phenylcyclohexanone
| Nome del prodotto |
2-Phenylcyclohexanone |
| Nome inglese |
2-Phenylcyclohexanone;AI3-07036; Cyclohexanone, 2-phenyl-; (2S)-2-phenylcyclohexanone; (2R)-2-phenylcyclohexanone |
| Formula molecolare |
C12H14O |
| Peso Molecolare |
174.239 |
| InChI |
InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
| Numero CAS |
1444-65-1 |
| EINECS |
215-888-7 |
| Struttura molecolare |
|
| Densità |
1.042g/cm3 |
| Punto di fusione |
56-59℃ |
| Punto di ebollizione |
294°C at 760 mmHg |
| Indice di rifrazione |
1.537 |
| Punto d'infiammabilità |
123.7°C |
| Pressione di vapore |
0.00167mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|