112-79-8 Elaidic acid
| Nome del prodotto |
Elaidic acid |
| Nome inglese |
Elaidic acid; trans-9-Octadecenoic acid~trans-Oleic acid; trans-9-Octadecenic acid; (9E)-octadec-9-enoic acid |
| Formula molecolare |
C18H34O2 |
| Peso Molecolare |
282.4614 |
| InChI |
InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
| Numero CAS |
112-79-8 |
| EINECS |
204-006-6 |
| Struttura molecolare |
|
| Densità |
0.899g/cm3 |
| Punto di fusione |
43-45℃ |
| Punto di ebollizione |
360°C at 760 mmHg |
| Indice di rifrazione |
1.466 |
| Punto d'infiammabilità |
270.1°C |
| Pressione di vapore |
3.7E-06mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|