103-43-5 dibenzyl succinate
| Nome del prodotto |
dibenzyl succinate |
| Nome inglese |
dibenzyl succinate; Dibenzyl succinate, (Succinic acid dibenzyl ester); Succinic acid dibenzyl ester; Butanedioic acid dibenzyl ester~Succinic acid dibenzyl ester; dibenzyl butanedioate |
| Formula molecolare |
C18H18O4 |
| Peso Molecolare |
298.3331 |
| InChI |
InChI=1/C18H18O4/c19-17(21-13-15-7-3-1-4-8-15)11-12-18(20)22-14-16-9-5-2-6-10-16/h1-10H,11-14H2 |
| Numero CAS |
103-43-5 |
| EINECS |
203-110-9 |
| Struttura molecolare |
|
| Densità |
1.165g/cm3 |
| Punto di ebollizione |
416.4°C at 760 mmHg |
| Indice di rifrazione |
1.556 |
| Punto d'infiammabilità |
205.7°C |
| Pressione di vapore |
3.82E-07mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|