700-44-7 6-Methoxysalicylaldehyde
| ??? ????? |
6-Methoxysalicylaldehyde |
| ??? ??????? |
6-Methoxysalicylaldehyde; 2-Hydroxy-6-methoxybenzaldehyde; 6-Hydroxy-o-anisaldehyde; 2-hydroxy-6-methoxy benzaldehyde |
| ????? ???????? |
C8H8O3 |
| ??? ??????? |
152.1473 |
| InChI |
InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
| ????? ?????? |
700-44-7 |
| ????? ??????? ??????? |
211-844-6 |
| ?????? ??????? |
|
| ????? |
1.231g/cm3 |
| ???? ????? |
262.9°C at 760 mmHg |
| ???? ???? |
1.587 |
| ???? ?????? |
107.8°C |
| ???? ???? |
0.00651mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|