ChemNet > CAS > 4247-02-3 isobutyl 4-hydroxybenzoate
4247-02-3 isobutyl 4-hydroxybenzoate
| ??? ????? |
isobutyl 4-hydroxybenzoate |
| ??? ??????? |
isobutyl 4-hydroxybenzoate; 4-Hydroxybenzoic acid isobutyl ester; Isobutyl paraben; 2-Methylpropyl 4-hydroxybenzoate; iso-Butyl Paraben; Isobutyl-P-Hydroxybenzoate; iso-Butyl p-Hydroxybenzoate |
| ????? ???????? |
C11H14O3 |
| ??? ??????? |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h3-6,8,12H,7H2,1-2H3 |
| ????? ?????? |
4247-02-3 |
| ????? ??????? ??????? |
224-208-8 |
| ?????? ??????? |
|
| ????? |
1.105g/cm3 |
| ???? ????? |
302.3°C at 760 mmHg |
| ???? ???? |
1.524 |
| ???? ?????? |
125.4°C |
| ???? ???? |
0.000556mmHg at 25°C |
| ??????? ????? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|