2050-23-9 Diethyl suberate
| ??? ????? |
Diethyl suberate |
| ??? ??????? |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| ????? ???????? |
C12H22O4 |
| ??? ??????? |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| ????? ?????? |
2050-23-9 |
| ????? ??????? ??????? |
218-084-4 |
| ?????? ??????? |
|
| ????? |
0.985g/cm3 |
| ???? ??? |
5-284℃ |
| ???? ????? |
282.6°C at 760 mmHg |
| ???? ???? |
1.436 |
| ???? ?????? |
123.3°C |
| ???? ???? |
0.00332mmHg at 25°C |
| ??????? ????? |
S24/25:Avoid contact with skin and eyes.;
|
|