ChemNet > CAS > 127-95-7 Potassium hydrogen oxalate
127-95-7 Potassium hydrogen oxalate
| ??? ????? |
Potassium hydrogen oxalate |
| ??? ??????? |
Potassium hydrogen oxalate; Potassium acid oxalate; Potassium binoxalate; Essential salt of lemon; Ethanedioic acid, monopotassium salt; HSDB 671; Kleesalz; Kleesalz [German]; Monopotassium oxalate; Oxalic acid, monopotassium salt; Potassium oxalate (KHC2O4); Potassium quadroxalate; Potassium salt of sorrel; Sal Acetosella; Salt of sorrel; Sorrel salt; Ethanedioic acid, potassium salt (1:1); dipotassium ethanedioate; Potassium Hydrogendi Oxalate |
| ????? ???????? |
C2K2O4 |
| ??? ??????? |
166.2156 |
| InChI |
InChI=1/C2H2O4.2K/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| ????? ?????? |
127-95-7 |
| ????? ??????? ??????? |
204-873-0 |
| ?????? ??????? |
|
| ???? ????? |
365.1°C at 760 mmHg |
| ???? ?????? |
188.8°C |
| ???? ???? |
2.51E-06mmHg at 25°C |
|