ChemNet > CAS > 10595-06-9 2-Phenoxyethyl methacrylate
10595-06-9 2-Phenoxyethyl methacrylate
| ??? ????? |
2-Phenoxyethyl methacrylate |
| ??? ??????? |
2-Phenoxyethyl methacrylate; |
| ????? ???????? |
C12H14O3 |
| ??? ??????? |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
| ????? ?????? |
10595-06-9 |
| ????? ??????? ??????? |
234-201-1 |
| ?????? ??????? |
|
| ????? |
1.059g/cm3 |
| ???? ????? |
292.352°C at 760 mmHg |
| ???? ???? |
1.501 |
| ???? ?????? |
118.277°C |
| ???? ???? |
0.002mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|