ChemNet > CAS > 104-18-7 (4-Aminophenylthio)acetic acid
104-18-7 (4-Aminophenylthio)acetic acid
| ??? ????? |
(4-Aminophenylthio)acetic acid |
| ??? ??????? |
(4-Aminophenylthio)acetic acid; 2-(4-Aminophenylthio)acetic acid; 4-Aminothiophenoxyacetic acid; [(4-aminophenyl)sulfanyl]acetic acid; [(4-aminophenyl)sulfanyl]acetate |
| ????? ???????? |
C8H8NO2S |
| ??? ??????? |
182.2202 |
| InChI |
InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
| ????? ?????? |
104-18-7 |
| ????? ??????? ??????? |
203-182-1 |
| ?????? ??????? |
|
| ???? ????? |
405.3°C at 760 mmHg |
| ???? ?????? |
198.9°C |
| ???? ???? |
2.69E-07mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|