7154-75-8 Methylpentyne
| ?????? ?? ??? |
Methylpentyne |
| ???????? ??? |
Methylpentyne; 1-pentyne, 4-methyl-; 4-Methylpent-1-yne; Isobutylethyne |
| ????? ???????? |
C6H10 |
| ?????? ??? |
82.1436 |
| InChI |
InChI=1/C6H10/c1-4-5-6(2)3/h1,6H,5H2,2-3H3 |
| ??? ??????? ?????? |
7154-75-8 |
| ????? ?????? |
|
| ????? |
0.735g/cm3 |
| ????? ?? ??? |
60°C at 760 mmHg |
| ??????? ??????? |
1.409 |
| ????? ?? ???? |
210mmHg at 25°C |
| ???? ?? ??? |
R11:Highly flammable.;
R65:Harmful: may cause lung damage if swallowed.;
|
| ??????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S29:Do not empty into drains.;
S33:Take precautionary measures against static discharges.;
S62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.;
|
|