4146-43-4 Succinic dihydrazide
| ?????? ?? ??? |
Succinic dihydrazide |
| ???????? ??? |
Succinic dihydrazide; Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
| ????? ???????? |
C4H10N4O2 |
| ?????? ??? |
146.1478 |
| InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
| ??? ??????? ?????? |
4146-43-4 |
| EINECS |
223-970-9 |
| ????? ?????? |
|
| ????? |
1.284g/cm3 |
| ?????? |
170-168℃ |
| ????? ?? ??? |
540.2°C at 760 mmHg |
| ??????? ??????? |
1.525 |
| ????? ??????? |
280.5°C |
| ????? ?? ???? |
9.79E-12mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|