300-08-3 Arecoline hydrobromide
| ?????? ?? ??? |
Arecoline hydrobromide |
| ???????? ??? |
Arecoline hydrobromide;methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide; methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1); 1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide; Arecoline HBr |
| ????? ???????? |
C8H14BrNO2 |
| ?????? ??? |
236.1063 |
| InChI |
InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
| ??? ??????? ?????? |
300-08-3 |
| EINECS |
206-087-3 |
| ????? ?????? |
|
| ?????? |
171-174℃ |
| ????? ?? ??? |
209°C at 760 mmHg |
| ????? ??????? |
81.1°C |
| ????? ?? ???? |
0.208mmHg at 25°C |
| ???? ?????? |
Xn:Harmful;
|
| ???? ?? ??? |
R22:;
|
| ??????? ????? |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|