ChemNet > CAS > 498-74-8 4-Methoxymetanilyl fluoride
498-74-8 4-Methoxymetanilyl fluoride
| ?? ????? |
4-Methoxymetanilyl fluoride |
| ?? ????? |
4-Methoxymetanilyl fluoride; 3-amino-4-methoxyphenylsulphonyl fluoride; Aminomethoxybenzenesulfonylfluoride; 3-Amino-4-methoxAV21428; 3-amino-4-methoxybenzenesulfonyl fluoride; 3-fluorobenzohydrazide |
| ????????? ??????? |
C7H7FN2O |
| ???? ???????? |
154.1417 |
| InChI |
InChI=1/C7H7FN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| ???? CAS |
498-74-8 |
| EINECS |
207-870-2 |
| ???? ???????? |
|
| ?????? |
1.272g/cm3 |
| ????? ????? |
60-65℃ |
| ????? ????? |
312.6°C at 760 mmHg |
| ???? ????? |
1.552 |
| ????? ???? |
142.8°C |
| ??? ???? |
0.000224mmHg at 25°C |
| Hazard ?????? |
Xi:Irritant;
|
| ??????? ???? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S24/25:Avoid contact with skin and eyes.;
|
|