937-41-7 Phenylacrylate
| Nama produk |
Phenylacrylate |
| Nama bahasa Inggris |
Phenylacrylate; Phenyl acrylate, (Acrylic acid phenyl ester); Acrylic acid phenyl ester; Phenylacrylate Phenyl acrylate; Phenyl acrylate; phenyl prop-2-enoate |
| MF |
C9H8O2 |
| Berat Molekul |
148.1586 |
| InChI |
InChI=1/C9H8O2/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2 |
| CAS NO |
937-41-7 |
| EINECS |
213-329-1 |
| Struktur Molekul |
|
| Kepadatan |
1.068g/cm3 |
| Titik didih |
232.2°C at 760 mmHg |
| Indeks bias |
1.517 |
| Titik nyala |
88.3°C |
| Tekanan uap |
0.0596mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|