ChemNet > CAS > 609-11-0 Ethyl 2,3-dibromobutyrate
609-11-0 Ethyl 2,3-dibromobutyrate
| Nama produk |
Ethyl 2,3-dibromobutyrate |
| Nama bahasa Inggris |
Ethyl 2,3-dibromobutyrate; 2,3-Dibromobutyric acid ethyl ester; 2,3-Dibromo-n-butyric acid ethyl ester; ethyl 2,3-dibromobutanoate |
| MF |
C6H10Br2O2 |
| Berat Molekul |
273.9504 |
| InChI |
InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
| CAS NO |
609-11-0 |
| EINECS |
210-177-8 |
| Struktur Molekul |
|
| Kepadatan |
1.731g/cm3 |
| Titik didih |
226.7°C at 760 mmHg |
| Indeks bias |
1.506 |
| Titik nyala |
90.9°C |
| Tekanan uap |
0.0809mmHg at 25°C |
| Kode Risiko |
R34:Causes burns.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|