3118-97-6 Sudan II
| Nama produk |
Sudan II |
| Nama bahasa Inggris |
Sudan II;C.I. 12140; C.I. Solvent Orange 7; C.I. Solvent Orange 7 (8CI); 1-(2,4-Dimethylphenylazo)-2-naphthol; Solvent Orange 7; sudan ii (C.I. 12140); 1-(2,4-XYLIDYLAZO)-2-NAPHTHOL; 1-[2,4-XYLYLAZO]-2-NAPHTHOL; FAT PONCEAU; CI 12140; CI NO 12140; CALCO OIL SCARLET BL; CALCO OIL SCARLET ZBL; 1-[(2,4-dimethylphenyl)hydrazono]naphthalen-2(1H)-one; (1E)-1-[(2,4-dimethylphenyl)hydrazono]naphthalen-2(1H)-one; Solvent Orange 7 |
| MF |
C18H16N2O |
| Berat Molekul |
276.3324 |
| InChI |
InChI=1/C18H16N2O/c1-12-7-9-16(13(2)11-12)19-20-18-15-6-4-3-5-14(15)8-10-17(18)21/h3-11,19H,1-2H3/b20-18+ |
| CAS NO |
3118-97-6 |
| EINECS |
221-490-4 |
| Struktur Molekul |
|
| Kepadatan |
1.14g/cm3 |
| Titik lebur |
156-158℃ |
| Titik didih |
429.6°C at 760 mmHg |
| Indeks bias |
1.615 |
| Titik nyala |
213.6°C |
| Tekanan uap |
1.38E-07mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R40:Possible risks of irreversible effects.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|