2373-89-9 4,4'-Dimethoxychalcone
| Nama produk |
4,4'-Dimethoxychalcone |
| Nama bahasa Inggris |
4,4'-Dimethoxychalcone; 4,4-Dimethoxybenzylideneacetophenone; 1,3-bis(4-methoxyphenyl)prop-2-en-1-one; (2E)-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
| MF |
C17H16O3 |
| Berat Molekul |
268.3071 |
| InChI |
InChI=1/C17H16O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3/b12-5+ |
| CAS NO |
2373-89-9 |
| Struktur Molekul |
|
| Kepadatan |
1.128g/cm3 |
| Titik didih |
444.6°C at 760 mmHg |
| Indeks bias |
1.591 |
| Titik nyala |
214.6°C |
| Tekanan uap |
4.23E-08mmHg at 25°C |
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|