1126-58-5 Girard's
| Nama produk |
Girard's |
| Nama bahasa Inggris |
Girard's; 1-(2-Hydrazino-2-oxoethyl)pyridinium chloride; 1126-58-5; Pyridinium, 1- (2-hydrazino-2-oxoethyl)-, chloride; pyridinium, 1-(2-hydrazinyl-2-oxoethyl)-, chloride (1:1); 1-(2-hydrazinyl-2-oxoethyl)pyridinium chloride |
| MF |
C7H10ClN3O |
| Berat Molekul |
187.6268 |
| InChI |
InChI=1/C7H9N3O.ClH/c8-9-7(11)6-10-4-2-1-3-5-10;/h1-5H,6,8H2;1H |
| CAS NO |
1126-58-5 |
| EINECS |
214-421-4 |
| Struktur Molekul |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|