96-86-6;16798-45-1 Diethyl benzamidomalonate
| termék neve |
Diethyl benzamidomalonate |
| Angol név |
Diethyl benzamidomalonate; Benzamidomalonic acid diethyl ester; diethyl (benzoylamino)propanedioate; diethyl (phenylcarbamoyl)propanedioate |
| MF |
C14H17NO5 |
| Molekulat?meg |
279.2885 |
| InChI |
InChI=1/C14H17NO5/c1-3-19-13(17)11(14(18)20-4-2)12(16)15-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3,(H,15,16) |
| CAS-szám |
96-86-6;16798-45-1 |
| EINECS |
202-540-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.22g/cm3 |
| Forráspont |
445.8°C at 760 mmHg |
| T?résmutató |
1.54 |
| Gyulladáspont |
223.4°C |
| G?znyomás |
3.82E-08mmHg at 25°C |
| Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|