ChemNet > CAS > 9011-14-7 Poly(methyl methacrylate)
9011-14-7;9065-11-6 Poly(methyl methacrylate)
| termék neve |
Poly(methyl methacrylate) |
| Angol név |
Poly(methyl methacrylate); Methyl Methacrylate Resin (High M.Wt.); Methacrylic Acid Methyl Ester, Polymer n=13,500-14,000; PMMA; 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer; Acryloid; Methyl methacrylate homopolymer; Methyl methacrylate, polymerized; Methyl methacrylate resin; Poly(methyl methacrylate), beads |
| MF |
(C5H8O2)x |
| Molekulat?meg |
99.1083 |
| InChI |
InChI=1/C5H7O2/c1-4(2)5(6)7-3/h1H,2-3H3 |
| CAS-szám |
9011-14-7;9065-11-6 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.18 |
| Olvadáspont |
105℃ |
| T?résmutató |
1.49 |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|