87-52-5 Gramine
| termék neve |
Gramine |
| Angol név |
Gramine; 3-(Dimethylaminomethyl)indole; (1H-Indol-3-ylmethyl)-dimethyl-amine |
| MF |
C11H14N2 |
| Molekulat?meg |
174.2423 |
| InChI |
InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
| CAS-szám |
87-52-5 |
| EINECS |
201-749-8 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.099g/cm3 |
| Olvadáspont |
131-139℃ |
| Forráspont |
293.9°C at 760 mmHg |
| T?résmutató |
1.63 |
| Gyulladáspont |
131.5°C |
| Vízben való oldhatóság |
PRACTICALLY INSOLUBLE |
| G?znyomás |
0.00168mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R36:Irritating to eyes.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
|
|