716-53-0 9-chloroanthracene
| termék neve |
9-chloroanthracene |
| Angol név |
9-chloroanthracene;Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
| MF |
C14H9Cl |
| Molekulat?meg |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| CAS-szám |
716-53-0 |
| EINECS |
211-937-1 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.253g/cm3 |
| Olvadáspont |
103-103℃ |
| Forráspont |
370.1°C at 760 mmHg |
| T?résmutató |
1.717 |
| Gyulladáspont |
179.2°C |
| G?znyomás |
2.42E-05mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|