626-27-7 Heptanoic anhydride
| termék neve |
Heptanoic anhydride |
| Angol név |
Heptanoic anhydride; Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
| MF |
C14H26O3 |
| Molekulat?meg |
242.3544 |
| InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
| CAS-szám |
626-27-7 |
| EINECS |
210-940-5 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.931g/cm3 |
| Olvadáspont |
-12℃ |
| Forráspont |
269.5°C at 760 mmHg |
| T?résmutató |
1.44 |
| Gyulladáspont |
129.9°C |
| G?znyomás |
0.00723mmHg at 25°C |
| Veszély szimbólumok |
C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|