621-63-6 2,2-diethoxyethanol
| termék neve |
2,2-diethoxyethanol |
| Angol név |
2,2-diethoxyethanol; Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
| MF |
C6H14O3 |
| Molekulat?meg |
134.1736 |
| InChI |
InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
| CAS-szám |
621-63-6 |
| EINECS |
210-697-5 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.97g/cm3 |
| Forráspont |
167°C at 760 mmHg |
| T?résmutató |
1.418 |
| Gyulladáspont |
68.4°C |
| G?znyomás |
0.574mmHg at 25°C |
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|