493-01-6;91-17-8 cis-Decahydronaphthalene
| termék neve |
cis-Decahydronaphthalene |
| Angol név |
cis-Decahydronaphthalene; cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
| MF |
C10H18 |
| Molekulat?meg |
138.2499 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| CAS-szám |
493-01-6;91-17-8 |
| EINECS |
202-046-9 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.873g/cm3 |
| Olvadáspont |
-31℃ |
| Forráspont |
190.879°C at 760 mmHg |
| T?résmutató |
1.47 |
| Gyulladáspont |
57.222°C |
| Vízben való oldhatóság |
6 mg/L at 20℃ |
| G?znyomás |
0.735mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|