ChemNet > CAS > 4411-26-1 1-Adamantyl isothiocyanate
4411-26-1 1-Adamantyl isothiocyanate
| termék neve |
1-Adamantyl isothiocyanate |
| Angol név |
1-Adamantyl isothiocyanate; tricyclo(3.3.1.13,7)dec-1-yl isocyanate; Isothiocyanic acid 1-adamantyl estr; 1-isothiocyanatotricyclo[3.3.1.1~3,7~]decane |
| MF |
C11H15NS |
| Molekulat?meg |
193.3085 |
| InChI |
InChI=1/C11H15NS/c13-7-12-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2 |
| CAS-szám |
4411-26-1 |
| EINECS |
224-564-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.35g/cm3 |
| Olvadáspont |
166-168℃ |
| Forráspont |
297.6°C at 760 mmHg |
| T?résmutató |
1.721 |
| Gyulladáspont |
138°C |
| G?znyomás |
0.00237mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|