15356-60-2 D-Menthol
| termék neve |
D-Menthol |
| Angol név |
D-Menthol; (1S,2R,5S)-(+)-Menthol; (1S,2R,5S)-2-Isopropyl-5-methylcyclohexanol; (1S,2R,5S)-5-methyl-2-(propan-2-yl)cyclohexanol; (1S,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanol; (+)-menthol |
| MF |
C10H20O |
| Molekulat?meg |
156.2652 |
| InChI |
InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m1/s1 |
| CAS-szám |
15356-60-2 |
| EINECS |
239-387-8 |
| Molekuláris szerkezete |
|
| S?r?ség |
0.89g/cm3 |
| Olvadáspont |
43-44℃ |
| Forráspont |
215.4°C at 760 mmHg |
| T?résmutató |
1.457 |
| Gyulladáspont |
93.3°C |
| G?znyomás |
0.0323mmHg at 25°C |
| Kockázatot kódok |
R37/38:Irritating to respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|