ChemNet > CAS > 940-64-7 (4-Methylphenoxy)acetic acid
940-64-7 (4-Methylphenoxy)acetic acid
| Ονομασ?α του προ??ντο? |
(4-Methylphenoxy)acetic acid |
| Αγγλικ? ?νομα |
(4-Methylphenoxy)acetic acid; 4-Methylphenoxyacetic acid; (p-Tolyloxy)-acetic acid; (4-methylphenoxy)acetate |
| MF |
C9H9O3 |
| Μοριακ? β?ρο? |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-7-2-4-8(5-3-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| CAS ΟΧΙ |
940-64-7 |
| EINECS |
213-374-7 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
141-142℃ |
| Σημε?ο βρασμο? |
297.2°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
120°C |
| Π?εση ατμ?ν |
0.000617mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|