87-64-9 2-Chloro-6-methylphenol
| Ονομασ?α του προ??ντο? |
2-Chloro-6-methylphenol |
| Αγγλικ? ?νομα |
2-Chloro-6-methylphenol; 2-Chloro-6-methylphenol,98%; 6-Chloro-o-cresol (OH=1); 6-Chloro-o-cresol |
| MF |
C7H7ClO |
| Μοριακ? β?ρο? |
142.5829 |
| InChI |
InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| CAS ΟΧΙ |
87-64-9 |
| EINECS |
201-760-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.228g/cm3 |
| Σημε?ο βρασμο? |
200.4°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.565 |
| Σημε?ο αν?φλεξη? |
75°C |
| Π?εση ατμ?ν |
0.229mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|