ChemNet > CAS > 637-39-8 Triethanolamine hydrochloride
637-39-8 Triethanolamine hydrochloride
| Ονομασ?α του προ??ντο? |
Triethanolamine hydrochloride |
| Αγγλικ? ?νομα |
Triethanolamine hydrochloride; 2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride; triethanolamine hcl; tris(2-hydroxyethyl)ammonium chloride; 2,2',2''-nitrilotriethanol hydrochloride (1:1) |
| MF |
C6H16ClNO3 |
| Μοριακ? β?ρο? |
185.6491 |
| InChI |
InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
| CAS ΟΧΙ |
637-39-8 |
| EINECS |
211-284-2 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
177-179℃ |
| Σημε?ο βρασμο? |
335.4°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
185°C |
| Π?εση ατμ?ν |
8.38E-06mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|