587-02-0 3-Ethylaniline
| Ονομασ?α του προ??ντο? |
3-Ethylaniline |
| Αγγλικ? ?νομα |
3-Ethylaniline;3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
| MF |
C8H11N |
| Μοριακ? β?ρο? |
121.1796 |
| InChI |
InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
| CAS ΟΧΙ |
587-02-0 |
| EINECS |
209-594-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.973g/cm3 |
| Σημε?ο τ?ξη? |
-8℃ |
| Σημε?ο βρασμο? |
216.6°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.556 |
| Σημε?ο αν?φλεξη? |
85°C |
| Π?εση ατμ?ν |
0.139mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
T:Toxic;
|
| Κινδ?νου Κ?δικε? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|