ChemNet > CAS > 5312-97-0 2,5-Dimethoxybenzonitrile
5312-97-0 2,5-Dimethoxybenzonitrile
| Ονομασ?α του προ??ντο? |
2,5-Dimethoxybenzonitrile |
| Αγγλικ? ?νομα |
2,5-Dimethoxybenzonitrile;3-{3-methoxy-4-[(3-methylbenzyl)oxy]phenyl}-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| MF |
C26H23N3O2 |
| Μοριακ? β?ρο? |
409.4797 |
| InChI |
InChI=1/C26H23N3O2/c1-17-5-4-6-20(11-17)16-31-24-10-8-19(14-25(24)30-3)13-21(15-27)26-28-22-9-7-18(2)12-23(22)29-26/h4-14H,16H2,1-3H3,(H,28,29) |
| CAS ΟΧΙ |
5312-97-0 |
| EINECS |
226-169-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.23g/cm3 |
| Σημε?ο τ?ξη? |
80-82℃ |
| Σημε?ο βρασμο? |
638°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.672 |
| Σημε?ο αν?φλεξη? |
339.6°C |
| Π?εση ατμ?ν |
3.55E-16mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|