ChemNet > CAS > 5253-02-1 alpha-ethyl-3-nitrocinnamic acid
5253-02-1 alpha-ethyl-3-nitrocinnamic acid
| Ονομασ?α του προ??ντο? |
alpha-ethyl-3-nitrocinnamic acid |
| Αγγλικ? ?νομα |
alpha-ethyl-3-nitrocinnamic acid;alpha-Ethyl-3-nitrocinnamic acid; 2-(3-nitrobenzylidene)butanoic acid; (2Z)-2-[(3-nitrophenyl)methylidene]butanoic acid; (2E)-2-[(3-nitrophenyl)methylidene]butanoic acid |
| MF |
C11H11NO4 |
| Μοριακ? β?ρο? |
221.2093 |
| InChI |
InChI=1/C11H11NO4/c1-2-9(11(13)14)6-8-4-3-5-10(7-8)12(15)16/h3-7H,2H2,1H3,(H,13,14)/b9-6+ |
| CAS ΟΧΙ |
5253-02-1 |
| EINECS |
226-054-7 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.303g/cm3 |
| Σημε?ο βρασμο? |
381.3°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.616 |
| Σημε?ο αν?φλεξη? |
164.2°C |
| Π?εση ατμ?ν |
1.71E-06mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|