4731-53-7 Tri-n-octylphosphine
| Ονομασ?α του προ??ντο? |
Tri-n-octylphosphine |
| Αγγλικ? ?νομα |
Tri-n-octylphosphine;Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
| MF |
C24H51P |
| Μοριακ? β?ρο? |
370.6355 |
| InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| CAS ΟΧΙ |
4731-53-7 |
| EINECS |
225-234-2 |
| Μοριακ? δομ? |
|
| Σημε?ο βρασμο? |
445°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
236°C |
| Π?εση ατμ?ν |
1.07E-07mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|