| Ονομασ?α του προ??ντο? |
L-Lactide S |
| Αγγλικ? ?νομα |
L-Lactide S; (3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
| MF |
C6H8O4 |
| Μοριακ? β?ρο? |
144.1253 |
| InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
| CAS ΟΧΙ |
4511-42-6 |
| EINECS |
224-832-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.186g/cm3 |
| Σημε?ο τ?ξη? |
92-98℃ |
| Σημε?ο βρασμο? |
285.5°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.429 |
| Σημε?ο αν?φλεξη? |
150.6°C |
| Π?εση ατμ?ν |
0.0028mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37:Irritating to eyes and respiratory system.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|