ChemNet > CAS > 2402-95-1 2-Chloropyridine-N-Oxide
2402-95-1 2-Chloropyridine-N-Oxide
| Ονομασ?α του προ??ντο? |
2-Chloropyridine-N-Oxide |
| Αγγλικ? ?νομα |
2-Chloropyridine-N-Oxide; 2-Chloropyridine N-oxide; 2-chloro-3-fluoropyridine 1-oxide |
| MF |
C5H3ClFNO |
| Μοριακ? β?ρο? |
147.5348 |
| InChI |
InChI=1/C5H3ClFNO/c6-5-4(7)2-1-3-8(5)9/h1-3H |
| CAS ΟΧΙ |
2402-95-1 |
| EINECS |
219-284-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.41g/cm3 |
| Σημε?ο βρασμο? |
317.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.53 |
| Σημε?ο αν?φλεξη? |
145.6°C |
| Π?εση ατμ?ν |
0.000733mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|