1641-17-4 mexenone
| Ονομασ?α του προ??ντο? |
mexenone |
| Αγγλικ? ?νομα |
mexenone; 2-Hydroxy-4-methoxy-4-methylbenzophenone; 2-HYDROXY-4-METHOXY-4'-METHYLBENZOPHENONE; LABOTEST-BB LT00455260; ''MEXENONE''; BENZOPHENONE-10; benzophenone-10,2-hydroxy-4-methoxy-4’-methylbenzophenone; (2-Hydroxy-4-methoxyphenyl)(4-methylphenyl)methanone; HYDROXYMETHOXYMETHYLBENZOPHENONE |
| MF |
C15H14O3 |
| Μοριακ? β?ρο? |
242.2699 |
| InChI |
InChI=1/C15H14O3/c1-10-3-5-11(6-4-10)15(17)13-8-7-12(18-2)9-14(13)16/h3-9,16H,1-2H3 |
| CAS ΟΧΙ |
1641-17-4 |
| EINECS |
216-688-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.174g/cm3 |
| Σημε?ο βρασμο? |
400.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.588 |
| Σημε?ο αν?φλεξη? |
150.2°C |
| Π?εση ατμ?ν |
5.65E-07mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|